C14H15BrN2 — CID 112618767
(E)-3-(5-bromoquinolin-8-yl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 112618767) has the molecular formula C14H15BrN2 and a molecular weight of 291.19 g/mol. Its IUPAC name is (E)-3-(5-bromoquinolin-8-yl)-N,2-dimethylprop-2-en-1-amine.
| Compound Name | (E)-3-(5-bromoquinolin-8-yl)-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 112618767 |
| Molecular Formula | C14H15BrN2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | (E)-3-(5-bromoquinolin-8-yl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | CNC/C(C)=C/c1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C14H15BrN2/c1-10(9-16-2)8-11-5-6-13(15)12-4-3-7-17-14(11)12/h3-8,16H,9H2,1-2H3/b10-8+ |
| InChIKey | JWVOJLQYMCVVKL-CSKARUKUSA-N |
| XLogP | 3.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |