C14H18F3N — CID 114058177
(E)-3-methyl-N-propyl-4-(2,4,5-trifluorophenyl)but-3-en-2-amine (PubChem CID 114058177) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is (E)-3-methyl-N-propyl-4-(2,4,5-trifluorophenyl)but-3-en-2-amine.
| Compound Name | (E)-3-methyl-N-propyl-4-(2,4,5-trifluorophenyl)but-3-en-2-amine |
|---|---|
| PubChem CID | 114058177 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (E)-3-methyl-N-propyl-4-(2,4,5-trifluorophenyl)but-3-en-2-amine |
| SMILES | CCCNC(C)/C(C)=C/c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H18F3N/c1-4-5-18-10(3)9(2)6-11-7-13(16)14(17)8-12(11)15/h6-8,10,18H,4-5H2,1-3H3/b9-6+ |
| InChIKey | SCAZFWRLBBEOAE-RMKNXTFCSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|