C12H12ClN3O3S — CID 103093928
4-amino-N-(3-chloro-2-pyridinyl)-2-methoxybenzenesulfonamide (PubChem CID 103093928) has the molecular formula C12H12ClN3O3S and a molecular weight of 313.77 g/mol. Its IUPAC name is 4-amino-N-(3-chloro-2-pyridinyl)-2-methoxybenzenesulfonamide.
| Compound Name | 4-amino-N-(3-chloro-2-pyridinyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 103093928 |
| Molecular Formula | C12H12ClN3O3S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 4-amino-N-(3-chloro-2-pyridinyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(N)ccc1S(=O)(=O)Nc1ncccc1Cl |
| InChI | InChI=1S/C12H12ClN3O3S/c1-19-10-7-8(14)4-5-11(10)20(17,18)16-12-9(13)3-2-6-15-12/h2-7H,14H2,1H3,(H,15,16) |
| InChIKey | JORAWQIGFKYCFE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|