C13H14ClN3O2S2 — CID 103093992
2-(3-aminophenyl)sulfanyl-N-(3-chloro-2-pyridinyl)ethanesulfonamide (PubChem CID 103093992) has the molecular formula C13H14ClN3O2S2 and a molecular weight of 343.86 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfanyl-N-(3-chloro-2-pyridinyl)ethanesulfonamide.
| Compound Name | 2-(3-aminophenyl)sulfanyl-N-(3-chloro-2-pyridinyl)ethanesulfonamide |
|---|---|
| PubChem CID | 103093992 |
| Molecular Formula | C13H14ClN3O2S2 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-(3-aminophenyl)sulfanyl-N-(3-chloro-2-pyridinyl)ethanesulfonamide |
| SMILES | Nc1cccc(SCCS(=O)(=O)Nc2ncccc2Cl)c1 |
| InChI | InChI=1S/C13H14ClN3O2S2/c14-12-5-2-6-16-13(12)17-21(18,19)8-7-20-11-4-1-3-10(15)9-11/h1-6,9H,7-8,15H2,(H,16,17) |
| InChIKey | WSDMAVPEOUIORD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|