C15H17ClN2O2 — CID 103094586
3-(3-chloro-2-pyridinyl)-3-azaspiro[5.5]undecane-2,4-dione (PubChem CID 103094586) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 3-(3-chloro-2-pyridinyl)-3-azaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-(3-chloro-2-pyridinyl)-3-azaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 103094586 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-(3-chloro-2-pyridinyl)-3-azaspiro[5.5]undecane-2,4-dione |
| SMILES | O=C1CC2(CCCCC2)CC(=O)N1c1ncccc1Cl |
| InChI | InChI=1S/C15H17ClN2O2/c16-11-5-4-8-17-14(11)18-12(19)9-15(10-13(18)20)6-2-1-3-7-15/h4-5,8H,1-3,6-7,9-10H2 |
| InChIKey | MMIMFPNYHATBGN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|