C12H18ClN3 — CID 107160290
[1-(3-chloro-2-pyridinyl)-4-methylpiperidin-4-yl]methanamine (PubChem CID 107160290) has the molecular formula C12H18ClN3 and a molecular weight of 239.75 g/mol. Its IUPAC name is [1-(3-chloro-2-pyridinyl)-4-methylpiperidin-4-yl]methanamine.
| Compound Name | [1-(3-chloro-2-pyridinyl)-4-methylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 107160290 |
| Molecular Formula | C12H18ClN3 |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | [1-(3-chloro-2-pyridinyl)-4-methylpiperidin-4-yl]methanamine |
| SMILES | CC1(CN)CCN(c2ncccc2Cl)CC1 |
| InChI | InChI=1S/C12H18ClN3/c1-12(9-14)4-7-16(8-5-12)11-10(13)3-2-6-15-11/h2-3,6H,4-5,7-9,14H2,1H3 |
| InChIKey | YXYDQNHTBJNFEM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |