C14H23N3 — CID 107160723
[4-methyl-1-[(3-methyl-2-pyridinyl)methyl]piperidin-4-yl]methanamine (PubChem CID 107160723) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is [4-methyl-1-[(3-methyl-2-pyridinyl)methyl]piperidin-4-yl]methanamine.
| Compound Name | [4-methyl-1-[(3-methyl-2-pyridinyl)methyl]piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 107160723 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | [4-methyl-1-[(3-methyl-2-pyridinyl)methyl]piperidin-4-yl]methanamine |
| SMILES | Cc1cccnc1CN1CCC(C)(CN)CC1 |
| InChI | InChI=1S/C14H23N3/c1-12-4-3-7-16-13(12)10-17-8-5-14(2,11-15)6-9-17/h3-4,7H,5-6,8-11,15H2,1-2H3 |
| InChIKey | HIBMZEUVHVGMII-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |