C16H20ClN5OS — CID 138690392
2-[4-(aminomethyl)-4-methylpiperidin-1-yl]-5-[(2-chloro-3-pyridinyl)sulfanyl]-1H-pyrimidin-6-one (PubChem CID 138690392) has the molecular formula C16H20ClN5OS and a molecular weight of 365.89 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-4-methylpiperidin-1-yl]-5-[(2-chloro-3-pyridinyl)sulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[4-(aminomethyl)-4-methylpiperidin-1-yl]-5-[(2-chloro-3-pyridinyl)sulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 138690392 |
| Molecular Formula | C16H20ClN5OS |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-[4-(aminomethyl)-4-methylpiperidin-1-yl]-5-[(2-chloro-3-pyridinyl)sulfanyl]-1H-pyrimidin-6-one |
| SMILES | CC1(CN)CCN(c2ncc(Sc3cccnc3Cl)c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C16H20ClN5OS/c1-16(10-18)4-7-22(8-5-16)15-20-9-12(14(23)21-15)24-11-3-2-6-19-13(11)17/h2-3,6,9H,4-5,7-8,10,18H2,1H3,(H,20,21,23) |
| InChIKey | DONOKQUMYLWEOH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|