C18H23ClN4S — CID 174250435
[1-[5-(2-chloro-3-methylphenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]methanamine (PubChem CID 174250435) has the molecular formula C18H23ClN4S and a molecular weight of 362.93 g/mol. Its IUPAC name is [1-[5-(2-chloro-3-methylphenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]methanamine.
| Compound Name | [1-[5-(2-chloro-3-methylphenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 174250435 |
| Molecular Formula | C18H23ClN4S |
| Molecular Weight | 362.93 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [1-[5-(2-chloro-3-methylphenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]methanamine |
| SMILES | Cc1cccc(Sc2cnc(N3CCC(C)(CN)CC3)cn2)c1Cl |
| InChI | InChI=1S/C18H23ClN4S/c1-13-4-3-5-14(17(13)19)24-16-11-21-15(10-22-16)23-8-6-18(2,12-20)7-9-23/h3-5,10-11H,6-9,12,20H2,1-2H3 |
| InChIKey | WJAFJMZARGBNDL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.93 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |