C17H17Cl2N5OS — CID 135194194
8-[5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-2-methyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene (PubChem CID 135194194) has the molecular formula C17H17Cl2N5OS and a molecular weight of 410.33 g/mol. Its IUPAC name is 8-[5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-2-methyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene.
| Compound Name | 8-[5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-2-methyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene |
|---|---|
| PubChem CID | 135194194 |
| Molecular Formula | C17H17Cl2N5OS |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 8-[5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-2-methyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene |
| SMILES | CC1=NC2(CCN(c3cnc(Sc4ccnc(Cl)c4Cl)cn3)CC2)CO1 |
| InChI | InChI=1S/C17H17Cl2N5OS/c1-11-23-17(10-25-11)3-6-24(7-4-17)13-8-22-14(9-21-13)26-12-2-5-20-16(19)15(12)18/h2,5,8-9H,3-4,6-7,10H2,1H3 |
| InChIKey | QCJAMZRWFCYFEB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|