C20H25ClN6S — CID 135197189
(3S,4R)-8-[5-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-3-ethenyl-8-azaspiro[4.5]decan-4-amine (PubChem CID 135197189) has the molecular formula C20H25ClN6S and a molecular weight of 416.98 g/mol. Its IUPAC name is (3S,4R)-8-[5-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-3-ethenyl-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (3S,4R)-8-[5-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-3-ethenyl-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 135197189 |
| Molecular Formula | C20H25ClN6S |
| Molecular Weight | 416.98 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (3S,4R)-8-[5-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-3-ethenyl-8-azaspiro[4.5]decan-4-amine |
| SMILES | C=C[C@@H]1CCC2(CCN(c3cnc(Sc4ccnc(N)c4Cl)cn3)CC2)[C@@H]1N |
| InChI | InChI=1S/C20H25ClN6S/c1-2-13-3-5-20(18(13)22)6-9-27(10-7-20)15-11-26-16(12-25-15)28-14-4-8-24-19(23)17(14)21/h2,4,8,11-13,18H,1,3,5-7,9-10,22H2,(H2,23,24)/t13-,18-/m1/s1 |
| InChIKey | WVKZMRYXMFDNRQ-FZKQIMNGSA-N |
| XLogP | 3.77 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.98 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|