C21H25ClN6S — CID 163831275
3-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-6-(3-cyclopropyl-8-azaspiro[4.5]dec-2-en-8-yl)pyrazin-2-amine (PubChem CID 163831275) has the molecular formula C21H25ClN6S and a molecular weight of 428.99 g/mol. Its IUPAC name is 3-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-6-(3-cyclopropyl-8-azaspiro[4.5]dec-2-en-8-yl)pyrazin-2-amine.
| Compound Name | 3-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-6-(3-cyclopropyl-8-azaspiro[4.5]dec-2-en-8-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 163831275 |
| Molecular Formula | C21H25ClN6S |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-6-(3-cyclopropyl-8-azaspiro[4.5]dec-2-en-8-yl)pyrazin-2-amine |
| SMILES | Nc1nc(N2CCC3(CC=C(C4CC4)C3)CC2)cnc1Sc1ccnc(N)c1Cl |
| InChI | InChI=1S/C21H25ClN6S/c22-17-15(4-8-25-18(17)23)29-20-19(24)27-16(12-26-20)28-9-6-21(7-10-28)5-3-14(11-21)13-1-2-13/h3-4,8,12-13H,1-2,5-7,9-11H2,(H2,23,25)(H2,24,27) |
| InChIKey | ODVPDFZMOHQANL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|