C17H20Cl2N6S — CID 123271805
7-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine (PubChem CID 123271805) has the molecular formula C17H20Cl2N6S and a molecular weight of 411.36 g/mol. Its IUPAC name is 7-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine.
| Compound Name | 7-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine |
|---|---|
| PubChem CID | 123271805 |
| Molecular Formula | C17H20Cl2N6S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 7-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine |
| SMILES | Nc1nc(N2CCC3(CCC3N)CC2)cnc1Sc1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C17H20Cl2N6S/c18-13-10(2-6-22-14(13)19)26-16-15(21)24-12(9-23-16)25-7-4-17(5-8-25)3-1-11(17)20/h2,6,9,11H,1,3-5,7-8,20H2,(H2,21,24) |
| InChIKey | UWTAVMJPLZOYDB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|