C18H22Cl2N6OS — CID 123531032
4-amino-8-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-8-azaspiro[4.5]decan-2-ol (PubChem CID 123531032) has the molecular formula C18H22Cl2N6OS and a molecular weight of 441.39 g/mol. Its IUPAC name is 4-amino-8-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-8-azaspiro[4.5]decan-2-ol.
| Compound Name | 4-amino-8-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-8-azaspiro[4.5]decan-2-ol |
|---|---|
| PubChem CID | 123531032 |
| Molecular Formula | C18H22Cl2N6OS |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 4-amino-8-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-8-azaspiro[4.5]decan-2-ol |
| SMILES | Nc1nc(N2CCC3(CC2)CC(O)CC3N)cnc1Sc1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C18H22Cl2N6OS/c19-14-11(1-4-23-15(14)20)28-17-16(22)25-13(9-24-17)26-5-2-18(3-6-26)8-10(27)7-12(18)21/h1,4,9-10,12,27H,2-3,5-8,21H2,(H2,22,25) |
| InChIKey | VCACXGULTWUFOL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|