C15H18Cl2N6OS — CID 118239415
[4-amino-1-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]piperidin-4-yl]methanol (PubChem CID 118239415) has the molecular formula C15H18Cl2N6OS and a molecular weight of 401.32 g/mol. Its IUPAC name is [4-amino-1-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]piperidin-4-yl]methanol.
| Compound Name | [4-amino-1-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 118239415 |
| Molecular Formula | C15H18Cl2N6OS |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | [4-amino-1-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]piperidin-4-yl]methanol |
| SMILES | Nc1nc(N2CCC(N)(CO)CC2)cnc1Sc1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C15H18Cl2N6OS/c16-11-9(1-4-20-12(11)17)25-14-13(18)22-10(7-21-14)23-5-2-15(19,8-24)3-6-23/h1,4,7,24H,2-3,5-6,8,19H2,(H2,18,22) |
| InChIKey | WBNAJTSDAUMQLB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|