C20H26ClN7OS — CID 150621154
(3aR)-1'-[6-amino-5-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]spiro[2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5,4'-piperidine]-4-amine (PubChem CID 150621154) has the molecular formula C20H26ClN7OS and a molecular weight of 448.00 g/mol. Its IUPAC name is (3aR)-1'-[6-amino-5-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]spiro[2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5,4'-piperidine]-4-amine.
| Compound Name | (3aR)-1'-[6-amino-5-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]spiro[2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5,4'-piperidine]-4-amine |
|---|---|
| PubChem CID | 150621154 |
| Molecular Formula | C20H26ClN7OS |
| Molecular Weight | 448.00 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (3aR)-1'-[6-amino-5-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]spiro[2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5,4'-piperidine]-4-amine |
| SMILES | Nc1nc(N2CCC3(CC2)CC2OCC[C@@H]2C3N)cnc1Sc1ccnc(N)c1Cl |
| InChI | InChI=1S/C20H26ClN7OS/c21-15-13(1-5-25-17(15)23)30-19-18(24)27-14(10-26-19)28-6-3-20(4-7-28)9-12-11(16(20)22)2-8-29-12/h1,5,10-12,16H,2-4,6-9,22H2,(H2,23,25)(H2,24,27)/t11-,12?,16?/m0/s1 |
| InChIKey | IVXXCPRRSMDJLN-FZWSLVFFSA-N |
| XLogP | 2.56 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.00 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |