C12H10Cl2N4O — CID 103094800
5-chloro-N-(3-chloro-2-pyridinyl)-2-(methylamino)pyridine-4-carboxamide (PubChem CID 103094800) has the molecular formula C12H10Cl2N4O and a molecular weight of 297.15 g/mol. Its IUPAC name is 5-chloro-N-(3-chloro-2-pyridinyl)-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | 5-chloro-N-(3-chloro-2-pyridinyl)-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103094800 |
| Molecular Formula | C12H10Cl2N4O |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 5-chloro-N-(3-chloro-2-pyridinyl)-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)Nc2ncccc2Cl)c(Cl)cn1 |
| InChI | InChI=1S/C12H10Cl2N4O/c1-15-10-5-7(9(14)6-17-10)12(19)18-11-8(13)3-2-4-16-11/h2-6H,1H3,(H,15,17)(H,16,18,19) |
| InChIKey | LVSWZHFRHNABPP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |