C14H13ClN2O — CID 103892998
N-(3-chloro-2-pyridinyl)-2,4-dimethylbenzamide (PubChem CID 103892998) has the molecular formula C14H13ClN2O and a molecular weight of 260.72 g/mol. Its IUPAC name is N-(3-chloro-2-pyridinyl)-2,4-dimethylbenzamide.
| Compound Name | N-(3-chloro-2-pyridinyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 103892998 |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | N-(3-chloro-2-pyridinyl)-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ncccc2Cl)c(C)c1 |
| InChI | InChI=1S/C14H13ClN2O/c1-9-5-6-11(10(2)8-9)14(18)17-13-12(15)4-3-7-16-13/h3-8H,1-2H3,(H,16,17,18) |
| InChIKey | FPXCBXGCTSOLOV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |