C14H10ClFN2 — CID 103095201
8-chloro-2-(2-fluorophenyl)-3-methylimidazo[1,2-a]pyridine (PubChem CID 103095201) has the molecular formula C14H10ClFN2 and a molecular weight of 260.70 g/mol. Its IUPAC name is 8-chloro-2-(2-fluorophenyl)-3-methylimidazo[1,2-a]pyridine.
| Compound Name | 8-chloro-2-(2-fluorophenyl)-3-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 103095201 |
| Molecular Formula | C14H10ClFN2 |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 8-chloro-2-(2-fluorophenyl)-3-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1c(-c2ccccc2F)nc2c(Cl)cccn12 |
| InChI | InChI=1S/C14H10ClFN2/c1-9-13(10-5-2-3-7-12(10)16)17-14-11(15)6-4-8-18(9)14/h2-8H,1H3 |
| InChIKey | PPIOJVKTSYSQFM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |