C11H15ClN4O — CID 103096084
3-(1-chlorobutyl)-5-(1,3-dimethylpyrazol-4-yl)-1,2,4-oxadiazole (PubChem CID 103096084) has the molecular formula C11H15ClN4O and a molecular weight of 254.72 g/mol. Its IUPAC name is 3-(1-chlorobutyl)-5-(1,3-dimethylpyrazol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chlorobutyl)-5-(1,3-dimethylpyrazol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103096084 |
| Molecular Formula | C11H15ClN4O |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 3-(1-chlorobutyl)-5-(1,3-dimethylpyrazol-4-yl)-1,2,4-oxadiazole |
| SMILES | CCCC(Cl)c1noc(-c2cn(C)nc2C)n1 |
| InChI | InChI=1S/C11H15ClN4O/c1-4-5-9(12)10-13-11(17-15-10)8-6-16(3)14-7(8)2/h6,9H,4-5H2,1-3H3 |
| InChIKey | OZEQLXPCKMIVER-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|