C14H17ClN2O3 — CID 103095783
3-(1-chlorobutyl)-5-(2,3-dimethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 103095783) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 3-(1-chlorobutyl)-5-(2,3-dimethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chlorobutyl)-5-(2,3-dimethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103095783 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-(1-chlorobutyl)-5-(2,3-dimethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | CCCC(Cl)c1noc(-c2cccc(OC)c2OC)n1 |
| InChI | InChI=1S/C14H17ClN2O3/c1-4-6-10(15)13-16-14(20-17-13)9-7-5-8-11(18-2)12(9)19-3/h5,7-8,10H,4,6H2,1-3H3 |
| InChIKey | BDOIJFFFWSBVOU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|