C10H10F2N2O3S — CID 103097651
N-(2,6-difluoro-3-pyridinyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 103097651) has the molecular formula C10H10F2N2O3S and a molecular weight of 276.26 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 103097651 |
| Molecular Formula | C10H10F2N2O3S |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)nc1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H10F2N2O3S/c11-8-2-1-7(9(12)14-8)13-10(15)6-3-4-18(16,17)5-6/h1-2,6H,3-5H2,(H,13,15) |
| InChIKey | HKFCVCCHJVPNON-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|