C8H8F2N2O3S — CID 103097646
N-(2,6-difluoro-3-pyridinyl)-2-methylsulfonylacetamide (PubChem CID 103097646) has the molecular formula C8H8F2N2O3S and a molecular weight of 250.23 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-2-methylsulfonylacetamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 103097646 |
| Molecular Formula | C8H8F2N2O3S |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-2-methylsulfonylacetamide |
| SMILES | CS(=O)(=O)CC(=O)Nc1ccc(F)nc1F |
| InChI | InChI=1S/C8H8F2N2O3S/c1-16(14,15)4-7(13)11-5-2-3-6(9)12-8(5)10/h2-3H,4H2,1H3,(H,11,13) |
| InChIKey | HJDQCMMAAVMZHH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|