C9H7F2N5O — CID 103097798
N-(2,6-difluoro-3-pyridinyl)-2-(triazol-1-yl)acetamide (PubChem CID 103097798) has the molecular formula C9H7F2N5O and a molecular weight of 239.19 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-2-(triazol-1-yl)acetamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-2-(triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 103097798 |
| Molecular Formula | C9H7F2N5O |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-2-(triazol-1-yl)acetamide |
| SMILES | O=C(Cn1ccnn1)Nc1ccc(F)nc1F |
| InChI | InChI=1S/C9H7F2N5O/c10-7-2-1-6(9(11)14-7)13-8(17)5-16-4-3-12-15-16/h1-4H,5H2,(H,13,17) |
| InChIKey | MIYRQVBGQFTEEU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|