C13H14ClN7O3 — CID 176575728
6-chloro-N-methyl-5-[[2-[[2-(triazol-1-yl)acetyl]amino]acetyl]amino]pyridine-2-carboxamide (PubChem CID 176575728) has the molecular formula C13H14ClN7O3 and a molecular weight of 351.75 g/mol. Its IUPAC name is 6-chloro-N-methyl-5-[[2-[[2-(triazol-1-yl)acetyl]amino]acetyl]amino]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-methyl-5-[[2-[[2-(triazol-1-yl)acetyl]amino]acetyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176575728 |
| Molecular Formula | C13H14ClN7O3 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 6-chloro-N-methyl-5-[[2-[[2-(triazol-1-yl)acetyl]amino]acetyl]amino]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(NC(=O)CNC(=O)Cn2ccnn2)c(Cl)n1 |
| InChI | InChI=1S/C13H14ClN7O3/c1-15-13(24)9-3-2-8(12(14)19-9)18-10(22)6-16-11(23)7-21-5-4-17-20-21/h2-5H,6-7H2,1H3,(H,15,24)(H,16,23)(H,18,22) |
| InChIKey | RQMBXVUSDFGYHI-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|