C11H11BrN4O — CID 79832173
N-(3-bromo-4-methylphenyl)-2-(triazol-1-yl)acetamide (PubChem CID 79832173) has the molecular formula C11H11BrN4O and a molecular weight of 295.14 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-2-(triazol-1-yl)acetamide.
| Compound Name | N-(3-bromo-4-methylphenyl)-2-(triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 79832173 |
| Molecular Formula | C11H11BrN4O |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-2-(triazol-1-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2ccnn2)cc1Br |
| InChI | InChI=1S/C11H11BrN4O/c1-8-2-3-9(6-10(8)12)14-11(17)7-16-5-4-13-15-16/h2-6H,7H2,1H3,(H,14,17) |
| InChIKey | UAKPLGNZVSMGMP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |