C15H18BrN5O3S — CID 155515130
N-[4-bromo-3-[(3S)-3-methylpyrrolidin-1-yl]sulfonylphenyl]-2-(triazol-1-yl)acetamide (PubChem CID 155515130) has the molecular formula C15H18BrN5O3S and a molecular weight of 428.31 g/mol. Its IUPAC name is N-[4-bromo-3-[(3S)-3-methylpyrrolidin-1-yl]sulfonylphenyl]-2-(triazol-1-yl)acetamide.
| Compound Name | N-[4-bromo-3-[(3S)-3-methylpyrrolidin-1-yl]sulfonylphenyl]-2-(triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 155515130 |
| Molecular Formula | C15H18BrN5O3S |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | N-[4-bromo-3-[(3S)-3-methylpyrrolidin-1-yl]sulfonylphenyl]-2-(triazol-1-yl)acetamide |
| SMILES | C[C@H]1CCN(S(=O)(=O)c2cc(NC(=O)Cn3ccnn3)ccc2Br)C1 |
| InChI | InChI=1S/C15H18BrN5O3S/c1-11-4-6-21(9-11)25(23,24)14-8-12(2-3-13(14)16)18-15(22)10-20-7-5-17-19-20/h2-3,5,7-8,11H,4,6,9-10H2,1H3,(H,18,22)/t11-/m0/s1 |
| InChIKey | TYCCKRHDRVLRNM-NSHDSACASA-N |
| XLogP | 1.71 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |