C12H12N4O3 — CID 113291668
2-methyl-5-[[2-(triazol-1-yl)acetyl]amino]benzoic acid (PubChem CID 113291668) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-methyl-5-[[2-(triazol-1-yl)acetyl]amino]benzoic acid.
| Compound Name | 2-methyl-5-[[2-(triazol-1-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 113291668 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-methyl-5-[[2-(triazol-1-yl)acetyl]amino]benzoic acid |
| SMILES | Cc1ccc(NC(=O)Cn2ccnn2)cc1C(=O)O |
| InChI | InChI=1S/C12H12N4O3/c1-8-2-3-9(6-10(8)12(18)19)14-11(17)7-16-5-4-13-15-16/h2-6H,7H2,1H3,(H,14,17)(H,18,19) |
| InChIKey | NPINKQOEAYGFGR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |