C10H8Cl2N4O2 — CID 82885275
N-(3,5-dichloro-4-hydroxyphenyl)-2-(triazol-1-yl)acetamide (PubChem CID 82885275) has the molecular formula C10H8Cl2N4O2 and a molecular weight of 287.11 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-2-(triazol-1-yl)acetamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-(triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 82885275 |
| Molecular Formula | C10H8Cl2N4O2 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-(triazol-1-yl)acetamide |
| SMILES | O=C(Cn1ccnn1)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2N4O2/c11-7-3-6(4-8(12)10(7)18)14-9(17)5-16-2-1-13-15-16/h1-4,18H,5H2,(H,14,17) |
| InChIKey | PNJFBFLHVJRVIS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|