C14H13FN4O2 — CID 115348470
N-[4-fluoro-2-(4-hydroxybut-1-ynyl)phenyl]-2-(triazol-1-yl)acetamide (PubChem CID 115348470) has the molecular formula C14H13FN4O2 and a molecular weight of 288.28 g/mol. Its IUPAC name is N-[4-fluoro-2-(4-hydroxybut-1-ynyl)phenyl]-2-(triazol-1-yl)acetamide.
| Compound Name | N-[4-fluoro-2-(4-hydroxybut-1-ynyl)phenyl]-2-(triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 115348470 |
| Molecular Formula | C14H13FN4O2 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N-[4-fluoro-2-(4-hydroxybut-1-ynyl)phenyl]-2-(triazol-1-yl)acetamide |
| SMILES | O=C(Cn1ccnn1)Nc1ccc(F)cc1C#CCCO |
| InChI | InChI=1S/C14H13FN4O2/c15-12-4-5-13(11(9-12)3-1-2-8-20)17-14(21)10-19-7-6-16-18-19/h4-7,9,20H,2,8,10H2,(H,17,21) |
| InChIKey | FUIMSSXKHACHGD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|