C9H4BrFN4O4 — CID 103099267
2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid (PubChem CID 103099267) has the molecular formula C9H4BrFN4O4 and a molecular weight of 331.06 g/mol. Its IUPAC name is 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid.
| Compound Name | 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 103099267 |
| Molecular Formula | C9H4BrFN4O4 |
| Molecular Weight | 331.06 g/mol |
| Exact Mass | 329.94 |
| IUPAC Name | 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid |
| SMILES | O=C(O)c1c(F)cccc1-n1nc([N+](=O)[O-])nc1Br |
| InChI | InChI=1S/C9H4BrFN4O4/c10-8-12-9(15(18)19)13-14(8)5-3-1-2-4(11)6(5)7(16)17/h1-3H,(H,16,17) |
| InChIKey | IZWFYORXMDJPSK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.06 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|