2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid

C9H4BrFN4O4 — CID 103099267

IUPAC2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid
SMILESO=C(O)c1c(F)cccc1-n1nc([N+](=O)[O-])nc1Br
InChIInChI=1S/C9H4BrFN4O4/c10-8-12-9(15(18)19)13-14(8)5-3-1-2-4(11)6(5)7(16)17/h1-3H,(H,16,17)
InChIKeyIZWFYORXMDJPSK-UHFFFAOYSA-N
MW331.06 g/mol
LogP1.78
Rot. Bonds3

About 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid

2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid (PubChem CID 103099267) has the molecular formula C9H4BrFN4O4 and a molecular weight of 331.06 g/mol. Its IUPAC name is 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid.

Molecular Properties

Compound Name2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid
PubChem CID103099267
Molecular FormulaC9H4BrFN4O4
Molecular Weight331.06 g/mol
Exact Mass329.94
IUPAC Name2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid
SMILESO=C(O)c1c(F)cccc1-n1nc([N+](=O)[O-])nc1Br
InChIInChI=1S/C9H4BrFN4O4/c10-8-12-9(15(18)19)13-14(8)5-3-1-2-4(11)6(5)7(16)17/h1-3H,(H,16,17)
InChIKeyIZWFYORXMDJPSK-UHFFFAOYSA-N
XLogP1.78
TPSA111.15 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.06
LogP ≤ 51.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid?
The IUPAC name of 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid (CID 103099267) is 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid.
What is the SMILES notation for 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid?
The canonical SMILES for 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid is O=C(O)c1c(F)cccc1-n1nc([N+](=O)[O-])nc1Br.
What is the InChIKey of 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid?
The InChIKey is IZWFYORXMDJPSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BrFN4O4/c10-8-12-9(15(18)19)13-14(8)5-3-1-2-4(11)6(5)7(16)17/h1-3H,(H,16,17).
What are the key properties of 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid?
2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid has a molecular weight of 331.06 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-6-fluorobenzoic acid is sourced from PubChem (CID 103099267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).