C9H3BrF2N4O4 — CID 103098343
4-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3,5-difluorobenzoic acid (PubChem CID 103098343) has the molecular formula C9H3BrF2N4O4 and a molecular weight of 349.05 g/mol. Its IUPAC name is 4-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3,5-difluorobenzoic acid.
| Compound Name | 4-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 103098343 |
| Molecular Formula | C9H3BrF2N4O4 |
| Molecular Weight | 349.05 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | 4-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3,5-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(-n2nc([N+](=O)[O-])nc2Br)c(F)c1 |
| InChI | InChI=1S/C9H3BrF2N4O4/c10-8-13-9(16(19)20)14-15(8)6-4(11)1-3(7(17)18)2-5(6)12/h1-2H,(H,17,18) |
| InChIKey | RWLGTUOFPMFKAG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.05 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|