C12H10Br2N4O3 — CID 103098804
4-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-1-(4-bromophenyl)butan-1-one (PubChem CID 103098804) has the molecular formula C12H10Br2N4O3 and a molecular weight of 418.05 g/mol. Its IUPAC name is 4-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-1-(4-bromophenyl)butan-1-one.
| Compound Name | 4-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-1-(4-bromophenyl)butan-1-one |
|---|---|
| PubChem CID | 103098804 |
| Molecular Formula | C12H10Br2N4O3 |
| Molecular Weight | 418.05 g/mol |
| Exact Mass | 415.91 |
| IUPAC Name | 4-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-1-(4-bromophenyl)butan-1-one |
| SMILES | O=C(CCCn1nc([N+](=O)[O-])nc1Br)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H10Br2N4O3/c13-9-5-3-8(4-6-9)10(19)2-1-7-17-11(14)15-12(16-17)18(20)21/h3-6H,1-2,7H2 |
| InChIKey | GVSVBGHTGBOBQO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.05 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|