About methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate
methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate (PubChem CID 103098311) has the molecular formula C10H8BrN5O4
and a molecular weight of 342.11 g/mol. Its IUPAC name is methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate |
| PubChem CID | 103098311 |
| Molecular Formula | C10H8BrN5O4 |
| Molecular Weight | 342.11 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(Cn2nc([N+](=O)[O-])nc2Br)nc1 |
| InChI | InChI=1S/C10H8BrN5O4/c1-20-8(17)6-2-3-7(12-4-6)5-15-9(11)13-10(14-15)16(18)19/h2-4H,5H2,1H3 |
| InChIKey | QJIZYCKGWJLXQR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.11 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate?
The IUPAC name of methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate (CID 103098311) is methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate?
The canonical SMILES for methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate is COC(=O)c1ccc(Cn2nc([N+](=O)[O-])nc2Br)nc1.
What is the InChIKey of methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate?
The InChIKey is QJIZYCKGWJLXQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrN5O4/c1-20-8(17)6-2-3-7(12-4-6)5-15-9(11)13-10(14-15)16(18)19/h2-4H,5H2,1H3.
What are the key properties of methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate?
methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate has a molecular weight of 342.11 g/mol, XLogP of 1.18, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate is sourced from PubChem (CID 103098311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).