C10H8BrN5O4 — CID 103098311
methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate (PubChem CID 103098311) has the molecular formula C10H8BrN5O4 and a molecular weight of 342.11 g/mol. Its IUPAC name is methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 103098311 |
| Molecular Formula | C10H8BrN5O4 |
| Molecular Weight | 342.11 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | methyl 6-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(Cn2nc([N+](=O)[O-])nc2Br)nc1 |
| InChI | InChI=1S/C10H8BrN5O4/c1-20-8(17)6-2-3-7(12-4-6)5-15-9(11)13-10(14-15)16(18)19/h2-4H,5H2,1H3 |
| InChIKey | QJIZYCKGWJLXQR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.11 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|