C16H19BrN2O — CID 61236647
1-(4-bromophenyl)-4-(3,4,5-trimethylpyrazol-1-yl)butan-1-one (PubChem CID 61236647) has the molecular formula C16H19BrN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-(3,4,5-trimethylpyrazol-1-yl)butan-1-one.
| Compound Name | 1-(4-bromophenyl)-4-(3,4,5-trimethylpyrazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 61236647 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-(4-bromophenyl)-4-(3,4,5-trimethylpyrazol-1-yl)butan-1-one |
| SMILES | Cc1nn(CCCC(=O)c2ccc(Br)cc2)c(C)c1C |
| InChI | InChI=1S/C16H19BrN2O/c1-11-12(2)18-19(13(11)3)10-4-5-16(20)14-6-8-15(17)9-7-14/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | CXHVUJJLVVNUMF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |