C9H13N5OS — CID 103102553
2-[(5-carbamothioylpyrazin-2-yl)-ethylamino]acetamide (PubChem CID 103102553) has the molecular formula C9H13N5OS and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-[(5-carbamothioylpyrazin-2-yl)-ethylamino]acetamide.
| Compound Name | 2-[(5-carbamothioylpyrazin-2-yl)-ethylamino]acetamide |
|---|---|
| PubChem CID | 103102553 |
| Molecular Formula | C9H13N5OS |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-[(5-carbamothioylpyrazin-2-yl)-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)c1cnc(C(N)=S)cn1 |
| InChI | InChI=1S/C9H13N5OS/c1-2-14(5-7(10)15)8-4-12-6(3-13-8)9(11)16/h3-4H,2,5H2,1H3,(H2,10,15)(H2,11,16) |
| InChIKey | SPNZDBSOXIXZJY-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|