C8H17N3O3S — CID 103104229
2-[ethyl(pyrrolidin-3-ylsulfonyl)amino]acetamide (PubChem CID 103104229) has the molecular formula C8H17N3O3S and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-[ethyl(pyrrolidin-3-ylsulfonyl)amino]acetamide.
| Compound Name | 2-[ethyl(pyrrolidin-3-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 103104229 |
| Molecular Formula | C8H17N3O3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-[ethyl(pyrrolidin-3-ylsulfonyl)amino]acetamide |
| SMILES | CCN(CC(N)=O)S(=O)(=O)C1CCNC1 |
| InChI | InChI=1S/C8H17N3O3S/c1-2-11(6-8(9)12)15(13,14)7-3-4-10-5-7/h7,10H,2-6H2,1H3,(H2,9,12) |
| InChIKey | IGSAETZQXZTHNJ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |