C16H19N3O2 — CID 103106922
ethyl 5-cyclopropyl-1-(2-phenylethyl)triazole-4-carboxylate (PubChem CID 103106922) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is ethyl 5-cyclopropyl-1-(2-phenylethyl)triazole-4-carboxylate.
| Compound Name | ethyl 5-cyclopropyl-1-(2-phenylethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103106922 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | ethyl 5-cyclopropyl-1-(2-phenylethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(CCc2ccccc2)c1C1CC1 |
| InChI | InChI=1S/C16H19N3O2/c1-2-21-16(20)14-15(13-8-9-13)19(18-17-14)11-10-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3 |
| InChIKey | PLRXLJOJVWGZDC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |