C29H44N2O4 — CID 10311077
tert-butyl 4-[(1R,3aS,3bR,5aR,9aR,9bS,11aS)-1-hydroxy-6,9a,11a-trimethyl-7-oxo-1,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-2-ylidene]piperidine-1-carboxylate (PubChem CID 10311077) has the molecular formula C29H44N2O4 and a molecular weight of 484.68 g/mol. Its IUPAC name is tert-butyl 4-[(1R,3aS,3bR,5aR,9aR,9bS,11aS)-1-hydroxy-6,9a,11a-trimethyl-7-oxo-1,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-2-ylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1R,3aS,3bR,5aR,9aR,9bS,11aS)-1-hydroxy-6,9a,11a-trimethyl-7-oxo-1,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-2-ylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10311077 |
| Molecular Formula | C29H44N2O4 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | tert-butyl 4-[(1R,3aS,3bR,5aR,9aR,9bS,11aS)-1-hydroxy-6,9a,11a-trimethyl-7-oxo-1,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-2-ylidene]piperidine-1-carboxylate |
| SMILES | CN1C(=O)C=C[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](O)C(=C5CCN(C(=O)OC(C)(C)C)CC5)C[C@H]4[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C29H44N2O4/c1-27(2,3)35-26(34)31-15-11-18(12-16-31)20-17-22-19-7-8-23-28(4,14-10-24(32)30(23)6)21(19)9-13-29(22,5)25(20)33/h10,14,19,21-23,25,33H,7-9,11-13,15-17H2,1-6H3/t19-,21+,22+,23-,25+,28-,29+/m1/s1 |
| InChIKey | PNSHWPVUGSZAJK-UXSWXVOHSA-N |
| XLogP | 4.92 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|