C25H37NO2 — CID 68983889
(3aS,3bR,9aR,9bR,11aS)-2-cyclohexylidene-1-hydroxy-6,9a,11a-trimethyl-1,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one (PubChem CID 68983889) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is (3aS,3bR,9aR,9bR,11aS)-2-cyclohexylidene-1-hydroxy-6,9a,11a-trimethyl-1,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bR,9aR,9bR,11aS)-2-cyclohexylidene-1-hydroxy-6,9a,11a-trimethyl-1,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 68983889 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | (3aS,3bR,9aR,9bR,11aS)-2-cyclohexylidene-1-hydroxy-6,9a,11a-trimethyl-1,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)C=C[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)C(O)C(=C3CCCCC3)C[C@@H]12 |
| InChI | InChI=1S/C25H37NO2/c1-24-14-12-22(27)26(3)21(24)10-9-17-19(24)11-13-25(2)20(17)15-18(23(25)28)16-7-5-4-6-8-16/h12,14,17,19-21,23,28H,4-11,13,15H2,1-3H3/t17-,19-,20+,21?,23?,24-,25+/m1/s1 |
| InChIKey | SLLPXFMIGUYPNG-JSSYLYDVSA-N |
| XLogP | 4.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|