C24H36N2O — CID 91401858
(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-1-piperidin-4-ylidene-2,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one (PubChem CID 91401858) has the molecular formula C24H36N2O and a molecular weight of 368.57 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-1-piperidin-4-ylidene-2,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-1-piperidin-4-ylidene-2,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 91401858 |
| Molecular Formula | C24H36N2O |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-1-piperidin-4-ylidene-2,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)C=C[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)C(=C3CCNCC3)CC[C@@H]12 |
| InChI | InChI=1S/C24H36N2O/c1-23-12-8-20-17(4-7-21-24(20,2)13-9-22(27)26(21)3)19(23)6-5-18(23)16-10-14-25-15-11-16/h9,13,17,19-21,25H,4-8,10-12,14-15H2,1-3H3/t17-,19-,20+,21?,23+,24+/m0/s1 |
| InChIKey | WAGLLVVUTXWCEI-KEMSCTOFSA-N |
| XLogP | 4.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|