C23H35NO4 — CID 91066736
ethyl 2-[(3aS,3bR,9aR,9bR,11aS)-1-hydroxy-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-1-yl]acetate (PubChem CID 91066736) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is ethyl 2-[(3aS,3bR,9aR,9bR,11aS)-1-hydroxy-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-1-yl]acetate.
| Compound Name | ethyl 2-[(3aS,3bR,9aR,9bR,11aS)-1-hydroxy-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-1-yl]acetate |
|---|---|
| PubChem CID | 91066736 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | ethyl 2-[(3aS,3bR,9aR,9bR,11aS)-1-hydroxy-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-1-yl]acetate |
| SMILES | CCOC(=O)CC1(O)CC[C@H]2[C@@H]3CCC4N(C)C(=O)C=C[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H35NO4/c1-5-28-20(26)14-23(27)13-9-17-15-6-7-18-21(2,11-10-19(25)24(18)4)16(15)8-12-22(17,23)3/h10-11,15-18,27H,5-9,12-14H2,1-4H3/t15-,16-,17+,18?,21-,22+,23?/m1/s1 |
| InChIKey | ACACBRLUYXKMBJ-RCJBWERMSA-N |
| XLogP | 3.31 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |