C26H34FNO2 — CID 10237858
(1S,2S,3aS,3bR,5aR,9aR,9bS,11aS)-2-[(2-fluorophenyl)methyl]-1-hydroxy-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 10237858) has the molecular formula C26H34FNO2 and a molecular weight of 411.56 g/mol. Its IUPAC name is (1S,2S,3aS,3bR,5aR,9aR,9bS,11aS)-2-[(2-fluorophenyl)methyl]-1-hydroxy-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (1S,2S,3aS,3bR,5aR,9aR,9bS,11aS)-2-[(2-fluorophenyl)methyl]-1-hydroxy-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 10237858 |
| Molecular Formula | C26H34FNO2 |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | (1S,2S,3aS,3bR,5aR,9aR,9bS,11aS)-2-[(2-fluorophenyl)methyl]-1-hydroxy-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)C=C[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](O)[C@H](Cc5ccccc5F)C[C@H]4[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C26H34FNO2/c1-25-13-11-23(29)28(3)22(25)9-8-18-19(25)10-12-26(2)20(18)15-17(24(26)30)14-16-6-4-5-7-21(16)27/h4-7,11,13,17-20,22,24,30H,8-10,12,14-15H2,1-3H3/t17-,18-,19+,20+,22-,24+,25-,26+/m1/s1 |
| InChIKey | JDAWWCHYYNWYLD-BMVNQAFVSA-N |
| XLogP | 4.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |