C8H14N2OS — CID 103113127
4-(2-amino-3-methylbutyl)-3H-1,3-thiazol-2-one (PubChem CID 103113127) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 4-(2-amino-3-methylbutyl)-3H-1,3-thiazol-2-one.
| Compound Name | 4-(2-amino-3-methylbutyl)-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 103113127 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 4-(2-amino-3-methylbutyl)-3H-1,3-thiazol-2-one |
| SMILES | CC(C)C(N)Cc1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H14N2OS/c1-5(2)7(9)3-6-4-12-8(11)10-6/h4-5,7H,3,9H2,1-2H3,(H,10,11) |
| InChIKey | NIHQWOKYROMGNU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |