C12H16N6O3 — CID 103115223
1-[1-(dimethylamino)-1-oxopropan-2-yl]-5-(1-methylpyrazol-4-yl)triazole-4-carboxylic acid (PubChem CID 103115223) has the molecular formula C12H16N6O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is 1-[1-(dimethylamino)-1-oxopropan-2-yl]-5-(1-methylpyrazol-4-yl)triazole-4-carboxylic acid.
| Compound Name | 1-[1-(dimethylamino)-1-oxopropan-2-yl]-5-(1-methylpyrazol-4-yl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103115223 |
| Molecular Formula | C12H16N6O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1-[1-(dimethylamino)-1-oxopropan-2-yl]-5-(1-methylpyrazol-4-yl)triazole-4-carboxylic acid |
| SMILES | CC(C(=O)N(C)C)n1nnc(C(=O)O)c1-c1cnn(C)c1 |
| InChI | InChI=1S/C12H16N6O3/c1-7(11(19)16(2)3)18-10(8-5-13-17(4)6-8)9(12(20)21)14-15-18/h5-7H,1-4H3,(H,20,21) |
| InChIKey | AQLKJWXJAQHMJG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |