C12H15N5O2 — CID 103115242
methyl 1-(cyclopropylmethyl)-5-(1-methylpyrazol-4-yl)triazole-4-carboxylate (PubChem CID 103115242) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is methyl 1-(cyclopropylmethyl)-5-(1-methylpyrazol-4-yl)triazole-4-carboxylate.
| Compound Name | methyl 1-(cyclopropylmethyl)-5-(1-methylpyrazol-4-yl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103115242 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | methyl 1-(cyclopropylmethyl)-5-(1-methylpyrazol-4-yl)triazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(CC2CC2)c1-c1cnn(C)c1 |
| InChI | InChI=1S/C12H15N5O2/c1-16-7-9(5-13-16)11-10(12(18)19-2)14-15-17(11)6-8-3-4-8/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | MJQCMRALWOOWCJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |