C14H21N5O2 — CID 103115280
methyl 1-(2-ethylbutyl)-5-(1-methylpyrazol-4-yl)triazole-4-carboxylate (PubChem CID 103115280) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is methyl 1-(2-ethylbutyl)-5-(1-methylpyrazol-4-yl)triazole-4-carboxylate.
| Compound Name | methyl 1-(2-ethylbutyl)-5-(1-methylpyrazol-4-yl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103115280 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | methyl 1-(2-ethylbutyl)-5-(1-methylpyrazol-4-yl)triazole-4-carboxylate |
| SMILES | CCC(CC)Cn1nnc(C(=O)OC)c1-c1cnn(C)c1 |
| InChI | InChI=1S/C14H21N5O2/c1-5-10(6-2)8-19-13(11-7-15-18(3)9-11)12(16-17-19)14(20)21-4/h7,9-10H,5-6,8H2,1-4H3 |
| InChIKey | KUYVLVKWACIEHP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |