C14H24N4O2 — CID 103126651
methyl 1-(2-ethylbutyl)-5-pyrrolidin-2-yltriazole-4-carboxylate (PubChem CID 103126651) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is methyl 1-(2-ethylbutyl)-5-pyrrolidin-2-yltriazole-4-carboxylate.
| Compound Name | methyl 1-(2-ethylbutyl)-5-pyrrolidin-2-yltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103126651 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | methyl 1-(2-ethylbutyl)-5-pyrrolidin-2-yltriazole-4-carboxylate |
| SMILES | CCC(CC)Cn1nnc(C(=O)OC)c1C1CCCN1 |
| InChI | InChI=1S/C14H24N4O2/c1-4-10(5-2)9-18-13(11-7-6-8-15-11)12(16-17-18)14(19)20-3/h10-11,15H,4-9H2,1-3H3 |
| InChIKey | RSBNXADQMRAECN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |