C13H15BrN4O2S — CID 103126600
methyl 1-[(5-bromothiophen-2-yl)methyl]-5-pyrrolidin-2-yltriazole-4-carboxylate (PubChem CID 103126600) has the molecular formula C13H15BrN4O2S and a molecular weight of 371.26 g/mol. Its IUPAC name is methyl 1-[(5-bromothiophen-2-yl)methyl]-5-pyrrolidin-2-yltriazole-4-carboxylate.
| Compound Name | methyl 1-[(5-bromothiophen-2-yl)methyl]-5-pyrrolidin-2-yltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103126600 |
| Molecular Formula | C13H15BrN4O2S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | methyl 1-[(5-bromothiophen-2-yl)methyl]-5-pyrrolidin-2-yltriazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(Cc2ccc(Br)s2)c1C1CCCN1 |
| InChI | InChI=1S/C13H15BrN4O2S/c1-20-13(19)11-12(9-3-2-6-15-9)18(17-16-11)7-8-4-5-10(14)21-8/h4-5,9,15H,2-3,6-7H2,1H3 |
| InChIKey | MFWPFLOXCGLRHL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |