C13H16N6O2 — CID 103126839
methyl 1-(pyrazin-2-ylmethyl)-5-pyrrolidin-2-yltriazole-4-carboxylate (PubChem CID 103126839) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is methyl 1-(pyrazin-2-ylmethyl)-5-pyrrolidin-2-yltriazole-4-carboxylate.
| Compound Name | methyl 1-(pyrazin-2-ylmethyl)-5-pyrrolidin-2-yltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103126839 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | methyl 1-(pyrazin-2-ylmethyl)-5-pyrrolidin-2-yltriazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(Cc2cnccn2)c1C1CCCN1 |
| InChI | InChI=1S/C13H16N6O2/c1-21-13(20)11-12(10-3-2-4-16-10)19(18-17-11)8-9-7-14-5-6-15-9/h5-7,10,16H,2-4,8H2,1H3 |
| InChIKey | WQVRGLPWLITECP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |